C14H18O3 — CID 165145663
ethyl 2-(1,3,4,5-tetrahydro-2-benzoxepin-5-yl)acetate (PubChem CID 165145663) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is ethyl 2-(1,3,4,5-tetrahydro-2-benzoxepin-5-yl)acetate.
| Compound Name | ethyl 2-(1,3,4,5-tetrahydro-2-benzoxepin-5-yl)acetate |
|---|---|
| PubChem CID | 165145663 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | ethyl 2-(1,3,4,5-tetrahydro-2-benzoxepin-5-yl)acetate |
| SMILES | CCOC(=O)CC1CCOCc2ccccc21 |
| InChI | InChI=1S/C14H18O3/c1-2-17-14(15)9-11-7-8-16-10-12-5-3-4-6-13(11)12/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | UTXZCSRHDZMTMN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |