C14H13ClO4 — CID 3763417
ethyl 5-chloro-7-methyl-5H-cyclopenta[f][1,3]benzodioxole-6-carboxylate (PubChem CID 3763417) has the molecular formula C14H13ClO4 and a molecular weight of 280.71 g/mol. Its IUPAC name is ethyl 5-chloro-7-methyl-5H-cyclopenta[f][1,3]benzodioxole-6-carboxylate.
| Compound Name | ethyl 5-chloro-7-methyl-5H-cyclopenta[f][1,3]benzodioxole-6-carboxylate |
|---|---|
| PubChem CID | 3763417 |
| Molecular Formula | C14H13ClO4 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | ethyl 5-chloro-7-methyl-5H-cyclopenta[f][1,3]benzodioxole-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)c2cc3c(cc2C1Cl)OCO3 |
| InChI | InChI=1S/C14H13ClO4/c1-3-17-14(16)12-7(2)8-4-10-11(19-6-18-10)5-9(8)13(12)15/h4-5,13H,3,6H2,1-2H3 |
| InChIKey | IMULTPHAOHJAOE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|