C17H18N2O6 — CID 88719613
ethyl 8-oxo-5-(1-oxobutan-2-ylamino)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate (PubChem CID 88719613) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is ethyl 8-oxo-5-(1-oxobutan-2-ylamino)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate.
| Compound Name | ethyl 8-oxo-5-(1-oxobutan-2-ylamino)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 88719613 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | ethyl 8-oxo-5-(1-oxobutan-2-ylamino)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylate |
| SMILES | CCOC(=O)c1cn(NC(C=O)CC)c2cc3c(cc2c1=O)OCO3 |
| InChI | InChI=1S/C17H18N2O6/c1-3-10(8-20)18-19-7-12(17(22)23-4-2)16(21)11-5-14-15(6-13(11)19)25-9-24-14/h5-8,10,18H,3-4,9H2,1-2H3 |
| InChIKey | DHHMQGCZFKWZFI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|