C17H21NO4 — CID 90894244
ethyl 1-(1-hydroxybutan-2-yl)-6-methyl-4-oxoquinoline-3-carboxylate (PubChem CID 90894244) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl 1-(1-hydroxybutan-2-yl)-6-methyl-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-(1-hydroxybutan-2-yl)-6-methyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 90894244 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl 1-(1-hydroxybutan-2-yl)-6-methyl-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C(CC)CO)c2ccc(C)cc2c1=O |
| InChI | InChI=1S/C17H21NO4/c1-4-12(10-19)18-9-14(17(21)22-5-2)16(20)13-8-11(3)6-7-15(13)18/h6-9,12,19H,4-5,10H2,1-3H3 |
| InChIKey | OIKLFWPFXWSMKJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |