C16H18INO4 — CID 59415853
ethyl 1-[(2R)-1-hydroxybutan-2-yl]-6-iodo-4-oxoquinoline-3-carboxylate (PubChem CID 59415853) has the molecular formula C16H18INO4 and a molecular weight of 415.23 g/mol. Its IUPAC name is ethyl 1-[(2R)-1-hydroxybutan-2-yl]-6-iodo-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-[(2R)-1-hydroxybutan-2-yl]-6-iodo-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 59415853 |
| Molecular Formula | C16H18INO4 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | ethyl 1-[(2R)-1-hydroxybutan-2-yl]-6-iodo-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn([C@H](CC)CO)c2ccc(I)cc2c1=O |
| InChI | InChI=1S/C16H18INO4/c1-3-11(9-19)18-8-13(16(21)22-4-2)15(20)12-7-10(17)5-6-14(12)18/h5-8,11,19H,3-4,9H2,1-2H3/t11-/m1/s1 |
| InChIKey | NCODUTDUHMGQIF-LLVKDONJSA-N |
| XLogP | 2.73 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|