C17H19IN2O3 — CID 59416049
ethyl 6-iodo-4-oxo-1-piperidin-3-ylquinoline-3-carboxylate (PubChem CID 59416049) has the molecular formula C17H19IN2O3 and a molecular weight of 426.25 g/mol. Its IUPAC name is ethyl 6-iodo-4-oxo-1-piperidin-3-ylquinoline-3-carboxylate.
| Compound Name | ethyl 6-iodo-4-oxo-1-piperidin-3-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 59416049 |
| Molecular Formula | C17H19IN2O3 |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | ethyl 6-iodo-4-oxo-1-piperidin-3-ylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CCCNC2)c2ccc(I)cc2c1=O |
| InChI | InChI=1S/C17H19IN2O3/c1-2-23-17(22)14-10-20(12-4-3-7-19-9-12)15-6-5-11(18)8-13(15)16(14)21/h5-6,8,10,12,19H,2-4,7,9H2,1H3 |
| InChIKey | VNTLZZVQPVCLJO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|