C17H18INO3 — CID 19081667
ethyl 1-cyclopentyl-7-iodo-4-oxoquinoline-3-carboxylate (PubChem CID 19081667) has the molecular formula C17H18INO3 and a molecular weight of 411.24 g/mol. Its IUPAC name is ethyl 1-cyclopentyl-7-iodo-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-cyclopentyl-7-iodo-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 19081667 |
| Molecular Formula | C17H18INO3 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | ethyl 1-cyclopentyl-7-iodo-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CCCC2)c2cc(I)ccc2c1=O |
| InChI | InChI=1S/C17H18INO3/c1-2-22-17(21)14-10-19(12-5-3-4-6-12)15-9-11(18)7-8-13(15)16(14)20/h7-10,12H,2-6H2,1H3 |
| InChIKey | YFYOXWYXARSUMO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|