C18H21IN2O3 — CID 59415796
ethyl 6-iodo-4-oxo-1-[[(3R)-piperidin-3-yl]methyl]quinoline-3-carboxylate (PubChem CID 59415796) has the molecular formula C18H21IN2O3 and a molecular weight of 440.28 g/mol. Its IUPAC name is ethyl 6-iodo-4-oxo-1-[[(3R)-piperidin-3-yl]methyl]quinoline-3-carboxylate.
| Compound Name | ethyl 6-iodo-4-oxo-1-[[(3R)-piperidin-3-yl]methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 59415796 |
| Molecular Formula | C18H21IN2O3 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | ethyl 6-iodo-4-oxo-1-[[(3R)-piperidin-3-yl]methyl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C[C@@H]2CCCNC2)c2ccc(I)cc2c1=O |
| InChI | InChI=1S/C18H21IN2O3/c1-2-24-18(23)15-11-21(10-12-4-3-7-20-9-12)16-6-5-13(19)8-14(16)17(15)22/h5-6,8,11-12,20H,2-4,7,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | GNQZSIVTUFLCEJ-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|