C25H26Cl3NO4 — CID 176792476
(14S)-21-butyl-16,17-dimethoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792476) has the molecular formula C25H26Cl3NO4 and a molecular weight of 510.85 g/mol. Its IUPAC name is (14S)-21-butyl-16,17-dimethoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | (14S)-21-butyl-16,17-dimethoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792476 |
| Molecular Formula | C25H26Cl3NO4 |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | (14S)-21-butyl-16,17-dimethoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | CCCCC1=C2c3cc4c(cc3CCN2[C@H](C(Cl)(Cl)Cl)c2c1ccc(OC)c2OC)OCO4 |
| InChI | InChI=1S/C25H26Cl3NO4/c1-4-5-6-16-15-7-8-18(30-2)23(31-3)21(15)24(25(26,27)28)29-10-9-14-11-19-20(33-13-32-19)12-17(14)22(16)29/h7-8,11-12,24H,4-6,9-10,13H2,1-3H3/t24-/m0/s1 |
| InChIKey | IJMOIGCMPNQIHZ-DEOSSOPVSA-N |
| XLogP | 6.77 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|