C31H30Cl3NO4 — CID 176792522
(15S)-17,18-dimethoxy-22-(3-phenylpropyl)-15-(trichloromethyl)-5,8-dioxa-14-azapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4(9),10,16(21),17,19-heptaene (PubChem CID 176792522) has the molecular formula C31H30Cl3NO4 and a molecular weight of 586.94 g/mol. Its IUPAC name is (15S)-17,18-dimethoxy-22-(3-phenylpropyl)-15-(trichloromethyl)-5,8-dioxa-14-azapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4(9),10,16(21),17,19-heptaene.
| Compound Name | (15S)-17,18-dimethoxy-22-(3-phenylpropyl)-15-(trichloromethyl)-5,8-dioxa-14-azapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4(9),10,16(21),17,19-heptaene |
|---|---|
| PubChem CID | 176792522 |
| Molecular Formula | C31H30Cl3NO4 |
| Molecular Weight | 586.94 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | (15S)-17,18-dimethoxy-22-(3-phenylpropyl)-15-(trichloromethyl)-5,8-dioxa-14-azapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4(9),10,16(21),17,19-heptaene |
| SMILES | COc1ccc2c(c1OC)[C@@H](C(Cl)(Cl)Cl)N1CCc3cc4c(cc3C1=C2CCCc1ccccc1)OCCO4 |
| InChI | InChI=1S/C31H30Cl3NO4/c1-36-24-12-11-21-22(10-6-9-19-7-4-3-5-8-19)28-23-18-26-25(38-15-16-39-26)17-20(23)13-14-35(28)30(31(32,33)34)27(21)29(24)37-2/h3-5,7-8,11-12,17-18,30H,6,9-10,13-16H2,1-2H3/t30-/m0/s1 |
| InChIKey | YCXOGUKBSMWORA-PMERELPUSA-N |
| XLogP | 7.65 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.94 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|