C26H27Cl4NO4 — CID 176792321
16-(6-chlorohexoxy)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792321) has the molecular formula C26H27Cl4NO4 and a molecular weight of 559.32 g/mol. Its IUPAC name is 16-(6-chlorohexoxy)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | 16-(6-chlorohexoxy)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792321 |
| Molecular Formula | C26H27Cl4NO4 |
| Molecular Weight | 559.32 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 16-(6-chlorohexoxy)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | COc1ccc2c(c1OCCCCCCCl)C(C(Cl)(Cl)Cl)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C26H27Cl4NO4/c1-32-20-7-6-17-12-19-18-14-22-21(34-15-35-22)13-16(18)8-10-31(19)25(26(28,29)30)23(17)24(20)33-11-5-3-2-4-9-27/h6-7,12-14,25H,2-5,8-11,15H2,1H3 |
| InChIKey | ZNYGNFKREVLXOB-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.32 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|