C25H24Cl4N2O3 — CID 176792490
16-(4-chloropiperidin-1-yl)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792490) has the molecular formula C25H24Cl4N2O3 and a molecular weight of 542.29 g/mol. Its IUPAC name is 16-(4-chloropiperidin-1-yl)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | 16-(4-chloropiperidin-1-yl)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792490 |
| Molecular Formula | C25H24Cl4N2O3 |
| Molecular Weight | 542.29 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 16-(4-chloropiperidin-1-yl)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | COc1ccc2c(c1N1CCC(Cl)CC1)C(C(Cl)(Cl)Cl)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C25H24Cl4N2O3/c1-32-19-3-2-15-10-18-17-12-21-20(33-13-34-21)11-14(17)4-9-31(18)24(25(27,28)29)22(15)23(19)30-7-5-16(26)6-8-30/h2-3,10-12,16,24H,4-9,13H2,1H3 |
| InChIKey | CMKPLKJBOIOIEP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.29 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|