C29H32F3N3O4 — CID 176792374
(14R)-14-cyclopentyl-17-methoxy-16-[4-(trifluoromethoxy)piperazin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792374) has the molecular formula C29H32F3N3O4 and a molecular weight of 543.59 g/mol. Its IUPAC name is (14R)-14-cyclopentyl-17-methoxy-16-[4-(trifluoromethoxy)piperazin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | (14R)-14-cyclopentyl-17-methoxy-16-[4-(trifluoromethoxy)piperazin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792374 |
| Molecular Formula | C29H32F3N3O4 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | (14R)-14-cyclopentyl-17-methoxy-16-[4-(trifluoromethoxy)piperazin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | COc1ccc2c(c1N1CCN(OC(F)(F)F)CC1)[C@@H](C1CCCC1)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C29H32F3N3O4/c1-36-23-7-6-20-14-22-21-16-25-24(37-17-38-25)15-19(21)8-9-35(22)27(18-4-2-3-5-18)26(20)28(23)33-10-12-34(13-11-33)39-29(30,31)32/h6-7,14-16,18,27H,2-5,8-13,17H2,1H3/t27-/m1/s1 |
| InChIKey | GPEHAPPVAHZLOW-HHHXNRCGSA-N |
| XLogP | 5.60 |
| TPSA | 46.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|