C30H33F3N2O3 — CID 176792667
(14R)-14-cyclopentyl-17-methoxy-16-[4-(trifluoromethyl)piperidin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792667) has the molecular formula C30H33F3N2O3 and a molecular weight of 526.60 g/mol. Its IUPAC name is (14R)-14-cyclopentyl-17-methoxy-16-[4-(trifluoromethyl)piperidin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | (14R)-14-cyclopentyl-17-methoxy-16-[4-(trifluoromethyl)piperidin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792667 |
| Molecular Formula | C30H33F3N2O3 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (14R)-14-cyclopentyl-17-methoxy-16-[4-(trifluoromethyl)piperidin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | COc1ccc2c(c1N1CCC(C(F)(F)F)CC1)[C@@H](C1CCCC1)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C30H33F3N2O3/c1-36-24-7-6-20-14-23-22-16-26-25(37-17-38-26)15-19(22)8-13-35(23)28(18-4-2-3-5-18)27(20)29(24)34-11-9-21(10-12-34)30(31,32)33/h6-7,14-16,18,21,28H,2-5,8-13,17H2,1H3/t28-/m1/s1 |
| InChIKey | PWNMLIKBEQOFDY-MUUNZHRXSA-N |
| XLogP | 6.80 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|