C26H24Cl3F3N2O4 — CID 176792458
(14S)-17-methoxy-14-(trichloromethyl)-16-[4-(trifluoromethoxy)piperidin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792458) has the molecular formula C26H24Cl3F3N2O4 and a molecular weight of 591.84 g/mol. Its IUPAC name is (14S)-17-methoxy-14-(trichloromethyl)-16-[4-(trifluoromethoxy)piperidin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | (14S)-17-methoxy-14-(trichloromethyl)-16-[4-(trifluoromethoxy)piperidin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792458 |
| Molecular Formula | C26H24Cl3F3N2O4 |
| Molecular Weight | 591.84 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | (14S)-17-methoxy-14-(trichloromethyl)-16-[4-(trifluoromethoxy)piperidin-1-yl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | COc1ccc2c(c1N1CCC(OC(F)(F)F)CC1)[C@@H](C(Cl)(Cl)Cl)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C26H24Cl3F3N2O4/c1-35-19-3-2-15-10-18-17-12-21-20(36-13-37-21)11-14(17)4-9-34(18)24(25(27,28)29)22(15)23(19)33-7-5-16(6-8-33)38-26(30,31)32/h2-3,10-12,16,24H,4-9,13H2,1H3/t24-/m0/s1 |
| InChIKey | UIHDTCCHRLAJHJ-DEOSSOPVSA-N |
| XLogP | 6.71 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.84 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|