C20H17NO4 — CID 176792372
(14R)-14-methyl-5,7,17,19-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(24),2,4(8),9,15(23),16(20),21-heptaene (PubChem CID 176792372) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (14R)-14-methyl-5,7,17,19-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(24),2,4(8),9,15(23),16(20),21-heptaene.
| Compound Name | (14R)-14-methyl-5,7,17,19-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(24),2,4(8),9,15(23),16(20),21-heptaene |
|---|---|
| PubChem CID | 176792372 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (14R)-14-methyl-5,7,17,19-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(24),2,4(8),9,15(23),16(20),21-heptaene |
| SMILES | C[C@@H]1c2c(ccc3c2OCO3)C=C2c3cc4c(cc3CCN21)OCO4 |
| InChI | InChI=1S/C20H17NO4/c1-11-19-13(2-3-16-20(19)25-10-22-16)6-15-14-8-18-17(23-9-24-18)7-12(14)4-5-21(11)15/h2-3,6-8,11H,4-5,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | ZUBDSDIMJIIQPP-LLVKDONJSA-N |
| XLogP | 3.57 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|