C27H32N2O6 — CID 176792533
tert-butyl N-[2-[[(14S)-17-methoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaen-16-yl]oxy]ethyl]carbamate (PubChem CID 176792533) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[(14S)-17-methoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaen-16-yl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(14S)-17-methoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaen-16-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176792533 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | tert-butyl N-[2-[[(14S)-17-methoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaen-16-yl]oxy]ethyl]carbamate |
| SMILES | COc1ccc2c(c1OCCNC(=O)OC(C)(C)C)[C@H](C)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C27H32N2O6/c1-16-24-18(6-7-21(31-5)25(24)32-11-9-28-26(30)35-27(2,3)4)12-20-19-14-23-22(33-15-34-23)13-17(19)8-10-29(16)20/h6-7,12-14,16H,8-11,15H2,1-5H3,(H,28,30)/t16-/m0/s1 |
| InChIKey | KOOYCTKKTNPLCR-INIZCTEOSA-N |
| XLogP | 4.76 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|