C26H28Cl3NO4 — CID 176792686
(14S)-16-(2-ethylbutoxy)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792686) has the molecular formula C26H28Cl3NO4 and a molecular weight of 524.87 g/mol. Its IUPAC name is (14S)-16-(2-ethylbutoxy)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | (14S)-16-(2-ethylbutoxy)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792686 |
| Molecular Formula | C26H28Cl3NO4 |
| Molecular Weight | 524.87 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | (14S)-16-(2-ethylbutoxy)-17-methoxy-14-(trichloromethyl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | CCC(CC)COc1c(OC)ccc2c1[C@@H](C(Cl)(Cl)Cl)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C26H28Cl3NO4/c1-4-15(5-2)13-32-24-20(31-3)7-6-17-10-19-18-12-22-21(33-14-34-22)11-16(18)8-9-30(19)25(23(17)24)26(27,28)29/h6-7,10-12,15,25H,4-5,8-9,13-14H2,1-3H3/t25-/m0/s1 |
| InChIKey | NHWHKYXXXGXSGJ-VWLOTQADSA-N |
| XLogP | 7.02 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.87 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|