C25H27NO4 — CID 176792720
(14S)-14-cyclopentyl-17-methoxy-16-(trideuteriomethoxy)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792720) has the molecular formula C25H27NO4 and a molecular weight of 408.51 g/mol. Its IUPAC name is (14S)-14-cyclopentyl-17-methoxy-16-(trideuteriomethoxy)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | (14S)-14-cyclopentyl-17-methoxy-16-(trideuteriomethoxy)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792720 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (14S)-14-cyclopentyl-17-methoxy-16-(trideuteriomethoxy)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | [2H]C([2H])([2H])Oc1c(OC)ccc2c1[C@H](C1CCCC1)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C25H27NO4/c1-27-20-8-7-17-11-19-18-13-22-21(29-14-30-22)12-16(18)9-10-26(19)24(15-5-3-4-6-15)23(17)25(20)28-2/h7-8,11-13,15,24H,3-6,9-10,14H2,1-2H3/t24-/m0/s1/i2D3 |
| InChIKey | FCVBXNIFFIYTOB-QKGYKGGZSA-N |
| XLogP | 5.03 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|