C29H26N2O4 — CID 102259135
16,17-dimethoxy-14-(3-methylindol-1-yl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 102259135) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 16,17-dimethoxy-14-(3-methylindol-1-yl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | 16,17-dimethoxy-14-(3-methylindol-1-yl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 102259135 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 16,17-dimethoxy-14-(3-methylindol-1-yl)-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | COc1ccc2c(c1OC)C(n1cc(C)c3ccccc31)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C29H26N2O4/c1-17-15-31(22-7-5-4-6-20(17)22)29-27-19(8-9-24(32-2)28(27)33-3)12-23-21-14-26-25(34-16-35-26)13-18(21)10-11-30(23)29/h4-9,12-15,29H,10-11,16H2,1-3H3 |
| InChIKey | UGHTYVFXQVEJDF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|