C25H27ClN2O3 — CID 176792414
(14R)-16-(4-chloropiperidin-1-yl)-17-methoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene (PubChem CID 176792414) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is (14R)-16-(4-chloropiperidin-1-yl)-17-methoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene.
| Compound Name | (14R)-16-(4-chloropiperidin-1-yl)-17-methoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 176792414 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (14R)-16-(4-chloropiperidin-1-yl)-17-methoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene |
| SMILES | COc1ccc2c(c1N1CCC(Cl)CC1)[C@@H](C)N1CCc3cc4c(cc3C1=C2)OCO4 |
| InChI | InChI=1S/C25H27ClN2O3/c1-15-24-17(3-4-21(29-2)25(24)27-8-6-18(26)7-9-27)11-20-19-13-23-22(30-14-31-23)12-16(19)5-10-28(15)20/h3-4,11-13,15,18H,5-10,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | LDFUTNNFZMWSGK-OAHLLOKOSA-N |
| XLogP | 5.06 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|