C22H20NO6+ — CID 3449604
2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-14-yl)acetic acid (PubChem CID 3449604) has the molecular formula C22H20NO6+ and a molecular weight of 394.40 g/mol. Its IUPAC name is 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-14-yl)acetic acid.
| Compound Name | 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-14-yl)acetic acid |
|---|---|
| PubChem CID | 3449604 |
| Molecular Formula | C22H20NO6+ |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-(16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-14-yl)acetic acid |
| SMILES | COc1ccc2cc3[n+](c(CC(=O)O)c2c1OC)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C22H19NO6/c1-26-17-4-3-13-7-15-14-9-19-18(28-11-29-19)8-12(14)5-6-23(15)16(10-20(24)25)21(13)22(17)27-2/h3-4,7-9H,5-6,10-11H2,1-2H3/p+1 |
| InChIKey | HBVQHBXRZAANIC-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|