C22H21N2O5+ — CID 10741220
(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) N,N-dimethylcarbamate (PubChem CID 10741220) has the molecular formula C22H21N2O5+ and a molecular weight of 393.42 g/mol. Its IUPAC name is (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) N,N-dimethylcarbamate.
| Compound Name | (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 10741220 |
| Molecular Formula | C22H21N2O5+ |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) N,N-dimethylcarbamate |
| SMILES | COc1ccc2cc3[n+](cc2c1OC(=O)N(C)C)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C22H21N2O5/c1-23(2)22(25)29-21-16-11-24-7-6-14-9-19-20(28-12-27-19)10-15(14)17(24)8-13(16)4-5-18(21)26-3/h4-5,8-11H,6-7,12H2,1-3H3/q+1 |
| InChIKey | CBBOKBNRUNKOAU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|