C27H21NO6 — CID 71496901
4-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxymethyl]benzoate (PubChem CID 71496901) has the molecular formula C27H21NO6 and a molecular weight of 455.47 g/mol. Its IUPAC name is 4-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxymethyl]benzoate.
| Compound Name | 4-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 71496901 |
| Molecular Formula | C27H21NO6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxymethyl]benzoate |
| SMILES | COc1ccc2cc3[n+](cc2c1OCc1ccc(C(=O)[O-])cc1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C27H21NO6/c1-31-23-7-6-18-10-22-20-12-25-24(33-15-34-25)11-19(20)8-9-28(22)13-21(18)26(23)32-14-16-2-4-17(5-3-16)27(29)30/h2-7,10-13H,8-9,14-15H2,1H3 |
| InChIKey | YYPICZZQTHSNNJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|