C33H34NO7+ — CID 56959300
2-[3-[6-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]hexoxy]phenyl]acetic acid (PubChem CID 56959300) has the molecular formula C33H34NO7+ and a molecular weight of 556.64 g/mol. Its IUPAC name is 2-[3-[6-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]hexoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[6-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]hexoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 56959300 |
| Molecular Formula | C33H34NO7+ |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 2-[3-[6-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]hexoxy]phenyl]acetic acid |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCCCCCOc1cccc(CC(=O)O)c1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C33H33NO7/c1-37-29-10-9-23-17-28-26-19-31-30(40-21-41-31)18-24(26)11-12-34(28)20-27(23)33(29)39-14-5-3-2-4-13-38-25-8-6-7-22(15-25)16-32(35)36/h6-10,15,17-20H,2-5,11-14,16,21H2,1H3/p+1 |
| InChIKey | UBNNDXFMDVVHIQ-UHFFFAOYSA-O |
| XLogP | 5.73 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|