C34H36NO7+ — CID 56959738
ethyl 2-[3-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentoxy]phenyl]acetate (PubChem CID 56959738) has the molecular formula C34H36NO7+ and a molecular weight of 570.66 g/mol. Its IUPAC name is ethyl 2-[3-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentoxy]phenyl]acetate.
| Compound Name | ethyl 2-[3-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentoxy]phenyl]acetate |
|---|---|
| PubChem CID | 56959738 |
| Molecular Formula | C34H36NO7+ |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | ethyl 2-[3-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(OCCCCCOc2c(OC)ccc3cc4[n+](cc23)CCc2cc3c(cc2-4)OCO3)c1 |
| InChI | InChI=1S/C34H36NO7/c1-3-38-33(36)17-23-8-7-9-26(16-23)39-14-5-4-6-15-40-34-28-21-35-13-12-25-19-31-32(42-22-41-31)20-27(25)29(35)18-24(28)10-11-30(34)37-2/h7-11,16,18-21H,3-6,12-15,17,22H2,1-2H3/q+1 |
| InChIKey | FSGIHENLMOXZES-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 76.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|