C23H24BrNO4 — CID 71517542
16-butoxy-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide (PubChem CID 71517542) has the molecular formula C23H24BrNO4 and a molecular weight of 458.35 g/mol. Its IUPAC name is 16-butoxy-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide.
| Compound Name | 16-butoxy-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide |
|---|---|
| PubChem CID | 71517542 |
| Molecular Formula | C23H24BrNO4 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 16-butoxy-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide |
| SMILES | CCCCOc1c(OC)ccc2cc3[n+](cc12)CCc1cc2c(cc1-3)OCO2.[Br-] |
| InChI | InChI=1S/C23H24NO4.BrH/c1-3-4-9-26-23-18-13-24-8-7-16-11-21-22(28-14-27-21)12-17(16)19(24)10-15(18)5-6-20(23)25-2;/h5-6,10-13H,3-4,7-9,14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CUQSCFDSWDGLDZ-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|