C22H21FNO4+ — CID 176791500
17-(2-fluoroethoxy)-18-methoxy-5,8-dioxa-14-azoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(14),2,4(9),10,15,17,19,21-octaene (PubChem CID 176791500) has the molecular formula C22H21FNO4+ and a molecular weight of 382.41 g/mol. Its IUPAC name is 17-(2-fluoroethoxy)-18-methoxy-5,8-dioxa-14-azoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(14),2,4(9),10,15,17,19,21-octaene.
| Compound Name | 17-(2-fluoroethoxy)-18-methoxy-5,8-dioxa-14-azoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(14),2,4(9),10,15,17,19,21-octaene |
|---|---|
| PubChem CID | 176791500 |
| Molecular Formula | C22H21FNO4+ |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 17-(2-fluoroethoxy)-18-methoxy-5,8-dioxa-14-azoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(14),2,4(9),10,15,17,19,21-octaene |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCF)CCc1cc2c(cc1-3)OCCO2 |
| InChI | InChI=1S/C22H21FNO4/c1-25-19-3-2-14-10-18-16-12-21-20(26-8-9-27-21)11-15(16)4-6-24(18)13-17(14)22(19)28-7-5-23/h2-3,10-13H,4-9H2,1H3/q+1 |
| InChIKey | XYDIXPHQTNGURK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|