C33H34ClNO7 — CID 56959590
ethyl 2-[4-[4-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]butoxy]phenyl]acetate chloride (PubChem CID 56959590) has the molecular formula C33H34ClNO7 and a molecular weight of 592.09 g/mol. Its IUPAC name is ethyl 2-[4-[4-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]butoxy]phenyl]acetate chloride.
| Compound Name | ethyl 2-[4-[4-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]butoxy]phenyl]acetate chloride |
|---|---|
| PubChem CID | 56959590 |
| Molecular Formula | C33H34ClNO7 |
| Molecular Weight | 592.09 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | ethyl 2-[4-[4-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]butoxy]phenyl]acetate chloride |
| SMILES | CCOC(=O)Cc1ccc(OCCCCOc2c(OC)ccc3cc4[n+](cc23)CCc2cc3c(cc2-4)OCO3)cc1.[Cl-] |
| InChI | InChI=1S/C33H34NO7.ClH/c1-3-37-32(35)16-22-6-9-25(10-7-22)38-14-4-5-15-39-33-27-20-34-13-12-24-18-30-31(41-21-40-30)19-26(24)28(34)17-23(27)8-11-29(33)36-2;/h6-11,17-20H,3-5,12-16,21H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZUFGLPKEUOJMCR-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 76.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.09 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|