C29H27ClN2O5 — CID 70685191
2-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]-N-(2-phenylethyl)acetamide chloride (PubChem CID 70685191) has the molecular formula C29H27ClN2O5 and a molecular weight of 519.00 g/mol. Its IUPAC name is 2-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]-N-(2-phenylethyl)acetamide chloride.
| Compound Name | 2-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]-N-(2-phenylethyl)acetamide chloride |
|---|---|
| PubChem CID | 70685191 |
| Molecular Formula | C29H27ClN2O5 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]-N-(2-phenylethyl)acetamide chloride |
| SMILES | COc1ccc2cc3[n+](cc2c1OCC(=O)NCCc1ccccc1)CCc1cc2c(cc1-3)OCO2.[Cl-] |
| InChI | InChI=1S/C29H26N2O5.ClH/c1-33-25-8-7-20-13-24-22-15-27-26(35-18-36-27)14-21(22)10-12-31(24)16-23(20)29(25)34-17-28(32)30-11-9-19-5-3-2-4-6-19;/h2-8,13-16H,9-12,17-18H2,1H3;1H |
| InChIKey | MTJXZRXIKJOBCU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 69.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|