C21H21NO7 — CID 11749917
6,7-dimethoxy-3-[6-(methoxymethoxymethyl)-1,3-benzodioxol-5-yl]-2H-isoquinolin-1-one (PubChem CID 11749917) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is 6,7-dimethoxy-3-[6-(methoxymethoxymethyl)-1,3-benzodioxol-5-yl]-2H-isoquinolin-1-one.
| Compound Name | 6,7-dimethoxy-3-[6-(methoxymethoxymethyl)-1,3-benzodioxol-5-yl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 11749917 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 6,7-dimethoxy-3-[6-(methoxymethoxymethyl)-1,3-benzodioxol-5-yl]-2H-isoquinolin-1-one |
| SMILES | COCOCc1cc2c(cc1-c1cc3cc(OC)c(OC)cc3c(=O)[nH]1)OCO2 |
| InChI | InChI=1S/C21H21NO7/c1-24-10-27-9-13-6-19-20(29-11-28-19)7-14(13)16-4-12-5-17(25-2)18(26-3)8-15(12)21(23)22-16/h4-8H,9-11H2,1-3H3,(H,22,23) |
| InChIKey | ICQAOWFJHORYBN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|