C21H19NO5 — CID 10618823
20-ethyl-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaen-19-one (PubChem CID 10618823) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 20-ethyl-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaen-19-one.
| Compound Name | 20-ethyl-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaen-19-one |
|---|---|
| PubChem CID | 10618823 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 20-ethyl-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaen-19-one |
| SMILES | CCn1c2c(c3cc(OC)c(OC)cc3c1=O)Cc1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C21H19NO5/c1-4-22-20-12-7-19-18(26-10-27-19)6-11(12)5-14(20)13-8-16(24-2)17(25-3)9-15(13)21(22)23/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | BFACEJSVHKMCKX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |