C30H35N3O7 — CID 86765191
15-[3-(dimethylamino)propoxy]-16-methoxy-20-(3-morpholin-4-ylpropyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione (PubChem CID 86765191) has the molecular formula C30H35N3O7 and a molecular weight of 549.62 g/mol. Its IUPAC name is 15-[3-(dimethylamino)propoxy]-16-methoxy-20-(3-morpholin-4-ylpropyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione.
| Compound Name | 15-[3-(dimethylamino)propoxy]-16-methoxy-20-(3-morpholin-4-ylpropyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
|---|---|
| PubChem CID | 86765191 |
| Molecular Formula | C30H35N3O7 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 15-[3-(dimethylamino)propoxy]-16-methoxy-20-(3-morpholin-4-ylpropyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
| SMILES | COc1cc2c(=O)n(CCCN3CCOCC3)c3c(c2cc1OCCCN(C)C)C(=O)c1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C30H35N3O7/c1-31(2)6-5-11-38-24-14-19-22(17-23(24)36-3)30(35)33(8-4-7-32-9-12-37-13-10-32)28-20-15-25-26(40-18-39-25)16-21(20)29(34)27(19)28/h14-17H,4-13,18H2,1-3H3 |
| InChIKey | WCTMZGOMAHLESC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|