C26H31N3O5 — CID 25015442
8-[2-(dimethylamino)ethoxy]-6-[2-(dimethylamino)ethyl]-2,3-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 25015442) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 8-[2-(dimethylamino)ethoxy]-6-[2-(dimethylamino)ethyl]-2,3-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 8-[2-(dimethylamino)ethoxy]-6-[2-(dimethylamino)ethyl]-2,3-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 25015442 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 8-[2-(dimethylamino)ethoxy]-6-[2-(dimethylamino)ethyl]-2,3-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1cc2c3c(n(CCN(C)C)c(=O)c2cc1OC)-c1cc(OCCN(C)C)ccc1C3=O |
| InChI | InChI=1S/C26H31N3O5/c1-27(2)9-10-29-24-19-13-16(34-12-11-28(3)4)7-8-17(19)25(30)23(24)18-14-21(32-5)22(33-6)15-20(18)26(29)31/h7-8,13-15H,9-12H2,1-6H3 |
| InChIKey | VCMGIJARUMPUHC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|