C25H29N3O3 — CID 24881885
9-[2-(dimethylamino)ethoxy]-6-[3-(dimethylamino)propyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 24881885) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 9-[2-(dimethylamino)ethoxy]-6-[3-(dimethylamino)propyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 9-[2-(dimethylamino)ethoxy]-6-[3-(dimethylamino)propyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 24881885 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 9-[2-(dimethylamino)ethoxy]-6-[3-(dimethylamino)propyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | CN(C)CCCn1c2c(c3ccccc3c1=O)C(=O)c1cc(OCCN(C)C)ccc1-2 |
| InChI | InChI=1S/C25H29N3O3/c1-26(2)12-7-13-28-23-19-11-10-17(31-15-14-27(3)4)16-21(19)24(29)22(23)18-8-5-6-9-20(18)25(28)30/h5-6,8-11,16H,7,12-15H2,1-4H3 |
| InChIKey | ANAAVSLAKWHNKD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|