C25H23NO7 — CID 155806071
20-(4-hydroxycyclohexyl)-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione (PubChem CID 155806071) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is 20-(4-hydroxycyclohexyl)-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione.
| Compound Name | 20-(4-hydroxycyclohexyl)-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
|---|---|
| PubChem CID | 155806071 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 20-(4-hydroxycyclohexyl)-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
| SMILES | COc1cc2c3c(n(C4CCC(O)CC4)c(=O)c2cc1OC)-c1cc2c(cc1C3=O)OCO2 |
| InChI | InChI=1S/C25H23NO7/c1-30-18-7-14-17(10-19(18)31-2)25(29)26(12-3-5-13(27)6-4-12)23-15-8-20-21(33-11-32-20)9-16(15)24(28)22(14)23/h7-10,12-13,27H,3-6,11H2,1-2H3 |
| InChIKey | KPIJPEYLBJRSMW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|