C16H15NO3 — CID 126101527
1-(6-methoxy-1,3-benzodioxol-5-yl)-N-(2-methylphenyl)methanimine (PubChem CID 126101527) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzodioxol-5-yl)-N-(2-methylphenyl)methanimine.
| Compound Name | 1-(6-methoxy-1,3-benzodioxol-5-yl)-N-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126101527 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-(6-methoxy-1,3-benzodioxol-5-yl)-N-(2-methylphenyl)methanimine |
| SMILES | COc1cc2c(cc1/C=N/c1ccccc1C)OCO2 |
| InChI | InChI=1S/C16H15NO3/c1-11-5-3-4-6-13(11)17-9-12-7-15-16(20-10-19-15)8-14(12)18-2/h3-9H,10H2,1-2H3/b17-9+ |
| InChIKey | HHNUEERMPWJXJB-RQZCQDPDSA-N |
| XLogP | 3.48 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|