C19H19NO5 — CID 126101193
methyl 3-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-2-methylbenzoate (PubChem CID 126101193) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl 3-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-2-methylbenzoate.
| Compound Name | methyl 3-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 126101193 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl 3-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-2-methylbenzoate |
| SMILES | CCOc1cc2c(cc1/C=N/c1cccc(C(=O)OC)c1C)OCO2 |
| InChI | InChI=1S/C19H19NO5/c1-4-23-16-9-18-17(24-11-25-18)8-13(16)10-20-15-7-5-6-14(12(15)2)19(21)22-3/h5-10H,4,11H2,1-3H3/b20-10+ |
| InChIKey | GINCYOSAVTVEDX-KEBDBYFISA-N |
| XLogP | 3.66 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|