C20H23NO3 — CID 126110552
N-(4-tert-butylphenyl)-1-(6-ethoxy-1,3-benzodioxol-5-yl)methanimine (PubChem CID 126110552) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-(6-ethoxy-1,3-benzodioxol-5-yl)methanimine.
| Compound Name | N-(4-tert-butylphenyl)-1-(6-ethoxy-1,3-benzodioxol-5-yl)methanimine |
|---|---|
| PubChem CID | 126110552 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-(6-ethoxy-1,3-benzodioxol-5-yl)methanimine |
| SMILES | CCOc1cc2c(cc1/C=N/c1ccc(C(C)(C)C)cc1)OCO2 |
| InChI | InChI=1S/C20H23NO3/c1-5-22-17-11-19-18(23-13-24-19)10-14(17)12-21-16-8-6-15(7-9-16)20(2,3)4/h6-12H,5,13H2,1-4H3/b21-12+ |
| InChIKey | GPULWRQTSMWWBF-CIAFOILYSA-N |
| XLogP | 4.86 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|