C17H16BrNO3 — CID 126102016
N-(4-bromo-3-methylphenyl)-1-(6-ethoxy-1,3-benzodioxol-5-yl)methanimine (PubChem CID 126102016) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-1-(6-ethoxy-1,3-benzodioxol-5-yl)methanimine.
| Compound Name | N-(4-bromo-3-methylphenyl)-1-(6-ethoxy-1,3-benzodioxol-5-yl)methanimine |
|---|---|
| PubChem CID | 126102016 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-1-(6-ethoxy-1,3-benzodioxol-5-yl)methanimine |
| SMILES | CCOc1cc2c(cc1/C=N/c1ccc(Br)c(C)c1)OCO2 |
| InChI | InChI=1S/C17H16BrNO3/c1-3-20-15-8-17-16(21-10-22-17)7-12(15)9-19-13-4-5-14(18)11(2)6-13/h4-9H,3,10H2,1-2H3/b19-9+ |
| InChIKey | IFRZWXIREFCGFS-DJKKODMXSA-N |
| XLogP | 4.64 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|