C17H14ClNO5 — CID 126106200
4-chloro-3-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]benzoic acid (PubChem CID 126106200) has the molecular formula C17H14ClNO5 and a molecular weight of 347.75 g/mol. Its IUPAC name is 4-chloro-3-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]benzoic acid.
| Compound Name | 4-chloro-3-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 126106200 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-chloro-3-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]benzoic acid |
| SMILES | CCOc1cc2c(cc1/C=N/c1cc(C(=O)O)ccc1Cl)OCO2 |
| InChI | InChI=1S/C17H14ClNO5/c1-2-22-14-7-16-15(23-9-24-16)6-11(14)8-19-13-5-10(17(20)21)3-4-12(13)18/h3-8H,2,9H2,1H3,(H,20,21)/b19-8+ |
| InChIKey | MCINZBCFCTYTRU-UFWORHAWSA-N |
| XLogP | 3.92 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|