C18H17ClN2O5 — CID 126108927
2-(4-chlorophenoxy)-N-[(E)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]acetamide (PubChem CID 126108927) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(E)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(E)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126108927 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(E)-(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| SMILES | CCOc1cc2c(cc1/C=N/NC(=O)COc1ccc(Cl)cc1)OCO2 |
| InChI | InChI=1S/C18H17ClN2O5/c1-2-23-15-8-17-16(25-11-26-17)7-12(15)9-20-21-18(22)10-24-14-5-3-13(19)4-6-14/h3-9H,2,10-11H2,1H3,(H,21,22)/b20-9+ |
| InChIKey | YUMAIZWQEVSDFD-AWQFTUOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|