C22H20N2O3 — CID 126103096
4-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-N-phenylaniline (PubChem CID 126103096) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-N-phenylaniline.
| Compound Name | 4-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-N-phenylaniline |
|---|---|
| PubChem CID | 126103096 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4-[(6-ethoxy-1,3-benzodioxol-5-yl)methylideneamino]-N-phenylaniline |
| SMILES | CCOc1cc2c(cc1/C=N/c1ccc(Nc3ccccc3)cc1)OCO2 |
| InChI | InChI=1S/C22H20N2O3/c1-2-25-20-13-22-21(26-15-27-22)12-16(20)14-23-17-8-10-19(11-9-17)24-18-6-4-3-5-7-18/h3-14,24H,2,15H2,1H3/b23-14+ |
| InChIKey | GOFFDOPNWQUTNJ-OEAKJJBVSA-N |
| XLogP | 5.31 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|