C19H23NO3 — CID 600803
1-(2,4-diethoxyphenyl)-N-(4-ethoxyphenyl)methanimine (PubChem CID 600803) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-(2,4-diethoxyphenyl)-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-(2,4-diethoxyphenyl)-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 600803 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-(2,4-diethoxyphenyl)-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2ccc(OCC)cc2OCC)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-4-21-17-11-8-16(9-12-17)20-14-15-7-10-18(22-5-2)13-19(15)23-6-3/h7-14H,4-6H2,1-3H3/b20-14+ |
| InChIKey | MPXWGURZLLJGNI-XSFVSMFZSA-N |
| XLogP | 4.63 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|