C13H20N2O2 — CID 110507423
N-[(E)-(2,4-diethoxyphenyl)methylideneamino]-N-methylmethanamine (PubChem CID 110507423) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is N-[(E)-(2,4-diethoxyphenyl)methylideneamino]-N-methylmethanamine.
| Compound Name | N-[(E)-(2,4-diethoxyphenyl)methylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 110507423 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-[(E)-(2,4-diethoxyphenyl)methylideneamino]-N-methylmethanamine |
| SMILES | CCOc1ccc(/C=N/N(C)C)c(OCC)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-5-16-12-8-7-11(10-14-15(3)4)13(9-12)17-6-2/h7-10H,5-6H2,1-4H3/b14-10+ |
| InChIKey | NDRFTVGUWQEBJG-GXDHUFHOSA-N |
| XLogP | 2.38 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|