C25H37N7O2 — CID 3695532
N-[(2,4-diethoxyphenyl)methylideneamino]-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 3695532) has the molecular formula C25H37N7O2 and a molecular weight of 467.62 g/mol. Its IUPAC name is N-[(2,4-diethoxyphenyl)methylideneamino]-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(2,4-diethoxyphenyl)methylideneamino]-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3695532 |
| Molecular Formula | C25H37N7O2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | N-[(2,4-diethoxyphenyl)methylideneamino]-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1ccc(C=NN(C)c2nc(N3CCCCC3)nc(N3CCCCC3)n2)c(OCC)c1 |
| InChI | InChI=1S/C25H37N7O2/c1-4-33-21-13-12-20(22(18-21)34-5-2)19-26-30(3)23-27-24(31-14-8-6-9-15-31)29-25(28-23)32-16-10-7-11-17-32/h12-13,18-19H,4-11,14-17H2,1-3H3 |
| InChIKey | YWHFOOLKHUDDBR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 79.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|