C10H11NO4 — CID 54152856
1-ethenyl-2,5-dimethoxy-4-nitrobenzene (PubChem CID 54152856) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 1-ethenyl-2,5-dimethoxy-4-nitrobenzene.
| Compound Name | 1-ethenyl-2,5-dimethoxy-4-nitrobenzene |
|---|---|
| PubChem CID | 54152856 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-ethenyl-2,5-dimethoxy-4-nitrobenzene |
| SMILES | C=Cc1cc(OC)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C10H11NO4/c1-4-7-5-10(15-3)8(11(12)13)6-9(7)14-2/h4-6H,1H2,2-3H3 |
| InChIKey | OIYILYYOIMFCOY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|