C13H19NO2 — CID 107430238
N-[(2-ethenyl-4,5-dimethoxyphenyl)methyl]ethanamine (PubChem CID 107430238) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[(2-ethenyl-4,5-dimethoxyphenyl)methyl]ethanamine.
| Compound Name | N-[(2-ethenyl-4,5-dimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107430238 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-[(2-ethenyl-4,5-dimethoxyphenyl)methyl]ethanamine |
| SMILES | C=Cc1cc(OC)c(OC)cc1CNCC |
| InChI | InChI=1S/C13H19NO2/c1-5-10-7-12(15-3)13(16-4)8-11(10)9-14-6-2/h5,7-8,14H,1,6,9H2,2-4H3 |
| InChIKey | LWEIHKGDCSDWCA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |