C7H7BrN2S — CID 145443882
4-(1-bromoethenyl)-5-ethenyl-1,3-thiazol-2-amine (PubChem CID 145443882) has the molecular formula C7H7BrN2S and a molecular weight of 231.12 g/mol. Its IUPAC name is 4-(1-bromoethenyl)-5-ethenyl-1,3-thiazol-2-amine.
| Compound Name | 4-(1-bromoethenyl)-5-ethenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145443882 |
| Molecular Formula | C7H7BrN2S |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 4-(1-bromoethenyl)-5-ethenyl-1,3-thiazol-2-amine |
| SMILES | C=Cc1sc(N)nc1C(=C)Br |
| InChI | InChI=1S/C7H7BrN2S/c1-3-5-6(4(2)8)10-7(9)11-5/h3H,1-2H2,(H2,9,10) |
| InChIKey | LLABOUFMEVSOHI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |