C7H9N2O2S- — CID 86661298
2-amino-5-propan-2-yl-1,3-thiazole-4-carboxylate (PubChem CID 86661298) has the molecular formula C7H9N2O2S- and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-amino-5-propan-2-yl-1,3-thiazole-4-carboxylate.
| Compound Name | 2-amino-5-propan-2-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 86661298 |
| Molecular Formula | C7H9N2O2S- |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 2-amino-5-propan-2-yl-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)c1sc(N)nc1C(=O)[O-] |
| InChI | InChI=1S/C7H10N2O2S/c1-3(2)5-4(6(10)11)9-7(8)12-5/h3H,1-2H3,(H2,8,9)(H,10,11)/p-1 |
| InChIKey | OTIUHHMZMCCWCU-UHFFFAOYSA-M |
| XLogP | 0.21 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |